2-chloro-N-[4-(3,4-dimethoxyphenyl)butyl]acetamide structure
|
Common Name | 2-chloro-N-[4-(3,4-dimethoxyphenyl)butyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 33760-10-0 | Molecular Weight | 285.76700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-chloro-N-[4-(3,4-dimethoxyphenyl)butyl]acetamide |
|---|
| Molecular Formula | C14H20ClNO3 |
|---|---|
| Molecular Weight | 285.76700 |
| Exact Mass | 285.11300 |
| PSA | 51.05000 |
| LogP | 3.22180 |
| InChIKey | BZEHNKYIUXOJCU-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCCCNC(=O)CCl)cc1OC |
|
~%
2-chloro-N-[4-(... CAS#:33760-10-0 |
| Literature: Hamada; Okuno; Ohmori; et al. Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 1 p. 128 - 136 |
|
~%
2-chloro-N-[4-(... CAS#:33760-10-0 |
| Literature: Hamada; Okuno; Ohmori; et al. Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 1 p. 128 - 136 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |