benzylidene-cyclohexyl-oxido-azanium
Modify Date: 2025-11-26 16:53:38
benzylidene-cyclohexyl-oxido-azanium structure
|
Common Name | benzylidene-cyclohexyl-oxido-azanium | ||
|---|---|---|---|---|
| CAS Number | 3376-25-8 | Molecular Weight | 203.28000 | |
| Density | 1.04g/cm3 | Boiling Point | 346.6ºC at 760 mmHg | |
| Molecular Formula | C13H17NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.4ºC | |
| Name | N-cyclohexyl-1-phenylmethanimine oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 346.6ºC at 760 mmHg |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28000 |
| Flash Point | 157.4ºC |
| Exact Mass | 203.13100 |
| PSA | 28.75000 |
| LogP | 3.47170 |
| Index of Refraction | 1.555 |
| InChIKey | ZJLVWLICFJLAGC-KAMYIIQDSA-N |
| SMILES | [O-][N+](=Cc1ccccc1)C1CCCCC1 |
| HS Code | 2925290090 |
|---|
|
~%
benzylidene-cyc... CAS#:3376-25-8 |
| Literature: Horner; Juergens Chemische Berichte, 1957 , vol. 90, p. 2184,2187 Full Text Show Details Thesing; Sirrenberg Chemische Berichte, 1958 , vol. 91, p. 1978 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:1759-68-8| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| BENZYLIDENE-CYCLOHEXYL-OXIDO-AZANIUM |
| N-Benzyliden-cyclohexylamin-N-oxid |