2H-Pyran-2,4(3H)-dione,3-[1-[(3-chlorophenyl)imino]ethyl]-6-methyl- structure
|
Common Name | 2H-Pyran-2,4(3H)-dione,3-[1-[(3-chlorophenyl)imino]ethyl]-6-methyl- | ||
|---|---|---|---|---|
| CAS Number | 33757-23-2 | Molecular Weight | 277.70300 | |
| Density | 1.29g/cm3 | Boiling Point | 443.5ºC at 760mmHg | |
| Molecular Formula | C14H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222ºC | |
| Name | 2H-Pyran-2,4(3H)-dione,3-[1-[(3-chlorophenyl)imino]ethyl]-6-methyl |
|---|
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 443.5ºC at 760mmHg |
| Molecular Formula | C14H12ClNO3 |
| Molecular Weight | 277.70300 |
| Flash Point | 222ºC |
| Exact Mass | 277.05100 |
| PSA | 55.73000 |
| LogP | 3.07830 |
| Index of Refraction | 1.59 |
| InChIKey | IYZVOUCJWLJXEN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C(C(C)=Nc2cccc(Cl)c2)C(=O)O1 |
|
~%
2H-Pyran-2,4(3H... CAS#:33757-23-2 |
| Literature: Mane; Patange; Arbad Journal of the Indian Chemical Society, 2007 , vol. 84, # 11 p. 1086 - 1091 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |