boc-4-nitro-l-phenylalanine structure
|
Common Name | boc-4-nitro-l-phenylalanine | ||
|---|---|---|---|---|
| CAS Number | 336877-68-0 | Molecular Weight | 310.30300 | |
| Density | 1.32g/cm3 | Boiling Point | 490.2ºC at 760 mmHg | |
| Molecular Formula | C14H18N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.2ºC | |
| Name | boc-4-nitro-l-phenylalanine |
|---|
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 490.2ºC at 760 mmHg |
| Molecular Formula | C14H18N2O6 |
| Molecular Weight | 310.30300 |
| Flash Point | 250.2ºC |
| Exact Mass | 310.11600 |
| PSA | 121.45000 |
| LogP | 3.02930 |
| Index of Refraction | 1.558 |
| InChIKey | MDWBEVONBWMBJG-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)O)c1ccc([N+](=O)[O-])cc1 |
|
~47%
boc-4-nitro-l-p... CAS#:336877-68-0 |
| Literature: Szeszel-Fedorowicz; Lisowski; Rosinski; Issberner; Osborne; Konopinska Polish Journal of Chemistry, 2001 , vol. 75, # 3 p. 411 - 417 |
|
~%
boc-4-nitro-l-p... CAS#:336877-68-0 |
| Literature: Szeszel-Fedorowicz; Lisowski; Rosinski; Issberner; Osborne; Konopinska Polish Journal of Chemistry, 2001 , vol. 75, # 3 p. 411 - 417 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |