2-chloro-2-nitrosoadamantane structure
|
Common Name | 2-chloro-2-nitrosoadamantane | ||
|---|---|---|---|---|
| CAS Number | 33673-34-6 | Molecular Weight | 199.67700 | |
| Density | 1.6g/cm3 | Boiling Point | 271.9ºC at 760mmHg | |
| Molecular Formula | C10H14ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 94ºC | |
| Name | 2-chloro-2-nitrosoadamantane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6g/cm3 |
|---|---|
| Boiling Point | 271.9ºC at 760mmHg |
| Molecular Formula | C10H14ClNO |
| Molecular Weight | 199.67700 |
| Flash Point | 94ºC |
| Exact Mass | 199.07600 |
| PSA | 29.43000 |
| LogP | 3.14400 |
| Index of Refraction | 1.735 |
| InChIKey | ZYQSPUNJUSBQMK-UHFFFAOYSA-N |
| SMILES | O=NC1(Cl)C2CC3CC(C2)CC1C3 |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,2-Chlornitrosoadamantan |
| ADAMANTANE,2-CHLORO-2-NITROSO |
| 2-Nitroso-2-chloroadamantane |
| 2-Chlor-2-nitrosoadamantan |