methyl1-benzhydrylazetidine-2-carboxylate
Modify Date: 2025-10-23 18:39:27
methyl1-benzhydrylazetidine-2-carboxylate structure
|
Common Name | methyl1-benzhydrylazetidine-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 33667-52-6 | Molecular Weight | 194.184 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 357.9±31.0 °C at 760 mmHg | |
| Molecular Formula | C10H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.9±18.3 °C | |
| Name | methyl 1-benzhydrylazetidine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 357.9±31.0 °C at 760 mmHg |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.184 |
| Flash Point | 145.9±18.3 °C |
| Exact Mass | 194.057907 |
| PSA | 29.54000 |
| LogP | 1.39 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.557 |
| InChIKey | COVUSEPDCOAOTR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCN1C(c1ccccc1)c1ccccc1 |
| HS Code | 2933990090 |
|---|
|
~50%
methyl1-benzhyd... CAS#:33667-52-6 |
| Literature: Starmans, Wim A. J.; Doppen, Roy G.; Thijs, Lambertus; Zwanenburg, Binne Tetrahedron Asymmetry, 1998 , vol. 9, # 3 p. 429 - 435 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![[1-(Diphenylmethyl)-2-azetidinyl]methanol structure](https://image.chemsrc.com/caspic/211/72351-68-9.png)
CAS#:72351-68-9| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl N-benzhydrylazetidine-2-carboxylate |
| 3,4-Dihydro-2H-1,5-benzodioxepine-2-carboxylic acid |
| 1-benzhydryl-azetidine-2-carboxylic acid methyl ester |
| methyl 1-(diphenylmethyl)azetidine-2-carboxylate |
| 1-diphenylmethyl-2-methoxycarbonylazetidine |
| 2H-1,5-Benzodioxepin-2-carboxylic acid, 3,4-dihydro- |
| methyl1-benzhydrylazetidine-2-carboxylate |