1,1,2,2-tetrachlorotetrafluorocyclobutane
1,1,2,2-tetrachlorotetrafluorocyclobutane structure
|
Common Name | 1,1,2,2-tetrachlorotetrafluorocyclobutane | ||
|---|---|---|---|---|
| CAS Number | 336-50-5 | Molecular Weight | 265.84800 | |
| Density | 1.82g/cm3 | Boiling Point | 132°C | |
| Molecular Formula | C4Cl4F4 | Melting Point | 84-86°C | |
| MSDS | N/A | Flash Point | 131-133°C | |
| Name | 1,1,2,2-tetrachloro-3,3,4,4-tetrafluorocyclobutane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.82g/cm3 |
|---|---|
| Boiling Point | 132°C |
| Melting Point | 84-86°C |
| Molecular Formula | C4Cl4F4 |
| Molecular Weight | 265.84800 |
| Flash Point | 131-133°C |
| Exact Mass | 263.86900 |
| LogP | 3.61840 |
| Index of Refraction | 1.44 |
| InChIKey | ZWDCJLJWIQMWBE-UHFFFAOYSA-N |
| SMILES | FC1(F)C(F)(F)C(Cl)(Cl)C1(Cl)Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2903890090 |
|
~%
1,1,2,2-tetrach... CAS#:336-50-5 |
| Literature: Journal of the American Chemical Society, , vol. 69, p. 279,281 |
|
~%
1,1,2,2-tetrach... CAS#:336-50-5
Detail
|
| Literature: Journal of Organic Chemistry, , vol. 38, p. 4026 - 4028 |
|
~%
1,1,2,2-tetrach... CAS#:336-50-5 |
| Literature: US2729613 , ; |
|
~%
1,1,2,2-tetrach... CAS#:336-50-5 |
| Literature: US2404374 , ; |
|
~%
1,1,2,2-tetrach... CAS#:336-50-5 |
| Literature: Industrial and Engineering Chemistry, , vol. 41, p. 71 |
|
~%
1,1,2,2-tetrach... CAS#:336-50-5 |
| Literature: Industrial and Engineering Chemistry, , vol. 41, p. 71 |
| Precursor 7 | |
|---|---|
| DownStream 3 | |
CAS#:694-62-2| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Cyclobutane,1,1,2,2-tetrachloro-3,3,4,4-tetrafluoro |
| EINECS 206-409-2 |
| 1,1,2,2-Tetrachlor-3,3,4,4-tetrafluor-cyclobutan |
| 1,1,2,2-Tetafluor-3,3,4,4-tetrachlor-cyclobutan |
| MFCD00039440 |
| 1,1,2,2-tetrachloro-3,3,4,4-tetrafluorocycloburane |
| 1,1,2,2-tetrachloro-3,3,4,4-tetrafluoro-cyclobutane |
| 1,1,2,2-Tetrachloro-3,3,4,4-tetrafluoro-cyclobutan |
| 1,1,2,2-Tetrachlorotetrafluorocyclobutane |
| 1,1,2,2-tetrachloro-3,3,4,4-tetrafluorotricyclobutane |