5-chloro-3-ethyl-2-methyl-1,3-benzothiazol-3-ium,iodide structure
|
Common Name | 5-chloro-3-ethyl-2-methyl-1,3-benzothiazol-3-ium,iodide | ||
|---|---|---|---|---|
| CAS Number | 33599-35-8 | Molecular Weight | 339.62400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11ClINS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-chloro-3-ethyl-2-methyl-1,3-benzothiazol-3-ium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H11ClINS |
|---|---|
| Molecular Weight | 339.62400 |
| Exact Mass | 338.93500 |
| PSA | 32.12000 |
| LogP | 0.17450 |
| InChIKey | JYJVFOJNPHDLFC-UHFFFAOYSA-M |
| SMILES | CC[n+]1c(C)sc2ccc(Cl)cc21.[I-] |
|
~33%
5-chloro-3-ethy... CAS#:33599-35-8 |
| Literature: Yue, Xiling; Yanez, Ciceron O.; Yao, Sheng; Belfield, Kevin D. Journal of the American Chemical Society, 2013 , vol. 135, # 6 p. 2112 - 2115 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5-chloro-3-ethyl-2-methylbenzothiazol-3-ium iodide |
| 5-chloro-3-ethyl-2-methylbenzothiazolium iodide |
| 3-ethyl-5-chloro-2-methyl-benzothiazolium,iodide |
| 3-Aethyl-5-chlor-2-methyl-benzothiazolium,Jodid |
| 2-Methyl-5-chlor-3-N-ethylbenzothiazoliumiodid |
| Benzothiazolium,5-chloro-3-ethyl-2-methyl-,iodide |