2-(2H-tetrazol-5-yl)chromen-4-one
Modify Date: 2025-11-30 09:56:55
2-(2H-tetrazol-5-yl)chromen-4-one structure
|
Common Name | 2-(2H-tetrazol-5-yl)chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 33543-91-8 | Molecular Weight | 214.18000 | |
| Density | 1.56g/cm3 | Boiling Point | 419.5ºC at 760 mmHg | |
| Molecular Formula | C10H6N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.5ºC | |
| Name | 2-(2H-tetrazol-5-yl)chromen-4-one |
|---|
| Density | 1.56g/cm3 |
|---|---|
| Boiling Point | 419.5ºC at 760 mmHg |
| Molecular Formula | C10H6N4O2 |
| Molecular Weight | 214.18000 |
| Flash Point | 207.5ºC |
| Exact Mass | 214.04900 |
| PSA | 84.67000 |
| LogP | 0.97310 |
| Index of Refraction | 1.697 |
| InChIKey | ZZLXVXGOFGHKHP-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2nn[nH]n2)oc2ccccc12 |
| HS Code | 2934999090 |
|---|
|
~%
2-(2H-tetrazol-... CAS#:33543-91-8 |
| Literature: Ellis; Shaw Journal of medicinal chemistry, 1972 , vol. 15, # 8 p. 865 - 867 |
|
~%
2-(2H-tetrazol-... CAS#:33543-91-8 |
| Literature: Geen, Graham R.; Giles, Robert G.; Grinter, Trevor J.; Hayler, John D.; Howie, Simon L. B.; Johnson, Graham; Mann, Inderjit S.; Novack, Vance J.; Oxley, Paul W.; Quick, John K.; Smith, Neil Synthetic Communications, 1997 , vol. 27, # 6 p. 1065 - 1073 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |