2-Chloro-6-methylcarbanilic acid 1-ethyl-4-piperidinyl ester
Modify Date: 2025-11-25 08:57:17
2-Chloro-6-methylcarbanilic acid 1-ethyl-4-piperidinyl ester structure
|
Common Name | 2-Chloro-6-methylcarbanilic acid 1-ethyl-4-piperidinyl ester | ||
|---|---|---|---|---|
| CAS Number | 33531-33-8 | Molecular Weight | 296.79200 | |
| Density | 1.19g/cm3 | Boiling Point | 358.9ºC at 760 mmHg | |
| Molecular Formula | C15H21ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.9ºC | |
| Name | (1-ethylpiperidin-4-yl) N-(2-chloro-6-methylphenyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 358.9ºC at 760 mmHg |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.79200 |
| Flash Point | 170.9ºC |
| Exact Mass | 296.12900 |
| PSA | 45.06000 |
| LogP | 3.63270 |
| Index of Refraction | 1.564 |
| InChIKey | UNVDLZFIUJGXJR-UHFFFAOYSA-N |
| SMILES | CCN1CCC(OC(=O)Nc2c(C)cccc2Cl)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| CARBANILIC ACID,2-CHLORO-6-METHYL-,N-ETHYL-4-PIPERIDINYL ESTER |
| 2-Chloro-6-methylcarbanilic acid,N-ethyl-4-piperidinyl ester |