3,4,5,6-Tetraphenyl-2H-pyran-2-one structure
|
Common Name | 3,4,5,6-Tetraphenyl-2H-pyran-2-one | ||
|---|---|---|---|---|
| CAS Number | 33524-67-3 | Molecular Weight | 400.46800 | |
| Density | 1.216g/cm3 | Boiling Point | 620.8ºC at 760 mmHg | |
| Molecular Formula | C29H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 260.1ºC | |
| Name | 3,4,5,6-tetraphenylpyran-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 620.8ºC at 760 mmHg |
| Molecular Formula | C29H20O2 |
| Molecular Weight | 400.46800 |
| Flash Point | 260.1ºC |
| Exact Mass | 400.14600 |
| PSA | 30.21000 |
| LogP | 7.30780 |
| Index of Refraction | 1.661 |
| InChIKey | QGLAPFHTDCRVOR-UHFFFAOYSA-N |
| SMILES | O=c1oc(-c2ccccc2)c(-c2ccccc2)c(-c2ccccc2)c1-c1ccccc1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,4,5,6-tetraphenyl-2H-pyran-2-one |
| 3,4,5,6-Tetraphenyl-pyran-2-on |
| 2H-Pyran-2-one,4,5,6-tetraphenyl |
| tetraphenyl-pyran-2-one |
| 3,4,5,6-Tetraphenyl-2H-pyran-2-on |