Methyl 6-methoxy-1-indanone-7-carboxylate
Modify Date: 2025-09-10 11:15:14
Methyl 6-methoxy-1-indanone-7-carboxylate structure
|
Common Name | Methyl 6-methoxy-1-indanone-7-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 33521-63-0 | Molecular Weight | 220.22100 | |
| Density | 1.245g/cm3 | Boiling Point | 384.027ºC at 760 mmHg | |
| Molecular Formula | C12H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.968ºC | |
| Name | methyl 5-methoxy-3-oxo-1,2-dihydroindene-4-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.245g/cm3 |
|---|---|
| Boiling Point | 384.027ºC at 760 mmHg |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22100 |
| Flash Point | 172.968ºC |
| Exact Mass | 220.07400 |
| PSA | 52.60000 |
| LogP | 1.61070 |
| Index of Refraction | 1.558 |
| InChIKey | RZXOQELJQWGFIS-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(OC)ccc2c1C(=O)CC2 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-methoxy-3-oxo-indan-4-carboxylic acid methyl ester |