2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanal structure
|
Common Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanal | ||
|---|---|---|---|---|
| CAS Number | 335-60-4 | Molecular Weight | 398.06900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8HF15O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanal |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8HF15O |
|---|---|
| Molecular Weight | 398.06900 |
| Exact Mass | 397.97900 |
| PSA | 17.07000 |
| LogP | 4.55940 |
| InChIKey | QIYBNKVPACGQCB-UHFFFAOYSA-N |
| SMILES | O=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2913000090 |
|---|
|
~%
2,2,3,3,4,4,5,5... CAS#:335-60-4 |
| Literature: Lang, Robert Werner Helvetica Chimica Acta, 1988 , vol. 71, p. 369 - 373 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| Pentadecafluor-octanal |
| Octanal,pentadecafluoro |
| pentadecafluoro-octanal |