dibutylbis(octyloxy)stannane
Modify Date: 2025-09-17 23:11:59
dibutylbis(octyloxy)stannane structure
|
Common Name | dibutylbis(octyloxy)stannane | ||
|---|---|---|---|---|
| CAS Number | 3349-38-0 | Molecular Weight | 491.36900 | |
| Density | N/A | Boiling Point | 194.7ºC at 760mmHg | |
| Molecular Formula | C24H52O2Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 81.1ºC | |
| Name | dibutyl(dioctoxy)stannane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 194.7ºC at 760mmHg |
|---|---|
| Molecular Formula | C24H52O2Sn |
| Molecular Weight | 491.36900 |
| Flash Point | 81.1ºC |
| Exact Mass | 492.29900 |
| PSA | 46.12000 |
| LogP | 8.41520 |
| InChIKey | UDXJOSPXJCRUGX-UHFFFAOYSA-N |
| SMILES | CCCCCCCCO[Sn](CCCC)(CCCC)OCCCCCCCC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Di-n-butyl-di-n-octyloxy-stannan |
| EINECS 222-104-7 |
| Dibutyl-dioctyloxy-stannan |
| dibutyl-dioctyloxytin |
| Dibutylzinn-di-n-octoxid |