N-dibutoxyphosphoryl-N,N,2-trimethyl-propanimidamide
Modify Date: 2025-08-25 17:04:24
N-dibutoxyphosphoryl-N,N,2-trimethyl-propanimidamide structure
|
Common Name | N-dibutoxyphosphoryl-N,N,2-trimethyl-propanimidamide | ||
|---|---|---|---|---|
| CAS Number | 3348-60-5 | Molecular Weight | 306.38100 | |
| Density | 1.02g/cm3 | Boiling Point | 354.8ºC at 760 mmHg | |
| Molecular Formula | C14H31N2O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.3ºC | |
| Name | n-(dibenzo[b,d]thiophen-3-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 354.8ºC at 760 mmHg |
| Molecular Formula | C14H31N2O3P |
| Molecular Weight | 306.38100 |
| Flash Point | 168.3ºC |
| Exact Mass | 306.20700 |
| PSA | 60.94000 |
| LogP | 4.34400 |
| Index of Refraction | 1.47 |
| InChIKey | BKVSHIVPXYXJOX-PFONDFGASA-N |
| SMILES | CCCCOP(=O)(N=C(C(C)C)N(C)C)OCCCC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Acetamide,N-3-dibenzothienyl |
| N'-Dibutoxyphosphoryl-N,N-dimethyl-isobutyramidin |
| N-3-Dibenzothienylacetamide |
| 3-Acetamidodibenzthiophene |
| 3-Acetaminodibenzothiophene |
| 3-Acetylaminodibenzothiophene |
| N-dibenzothiophen-3-yl-acetamide |