6-hydroxy-1,3-dimethyl-5-nitro-pyrimidine-2,4-dione
Modify Date: 2025-12-01 11:53:08
6-hydroxy-1,3-dimethyl-5-nitro-pyrimidine-2,4-dione structure
|
Common Name | 6-hydroxy-1,3-dimethyl-5-nitro-pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 3346-62-1 | Molecular Weight | 201.13700 | |
| Density | 1.67g/cm3 | Boiling Point | 261.4ºC at 760 mmHg | |
| Molecular Formula | C6H7N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 111.9ºC | |
| Name | 6-hydroxy-1,3-dimethyl-5-nitropyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.67g/cm3 |
|---|---|
| Boiling Point | 261.4ºC at 760 mmHg |
| Molecular Formula | C6H7N3O5 |
| Molecular Weight | 201.13700 |
| Flash Point | 111.9ºC |
| Exact Mass | 201.03900 |
| PSA | 110.05000 |
| Index of Refraction | 1.632 |
| InChIKey | LNCMPHONLFYCDM-UHFFFAOYSA-N |
| SMILES | Cn1c(O)c([N+](=O)[O-])c(=O)n(C)c1=O |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-dimethyl-5-nitro-pyrimidine-2,4,6-trione |
| 1,3-Dimethyl-5-nitrobarbituric acid |
| 6-hydroxy-1,3-dimethyl-5-nitropyrimidine-2,4(1H,3H)-dione |
| 1,3-Dimethyl-5-nitro-6-hydroxy-2,4-dioxo-1,2,3,4-tetrahydro-pyrimidin |
| 5-Nitro-1.3-dimethyl-barbitursaeure |