Benzoic acid 2-(2,4,6-trichlorophenyl) hydrazide
Modify Date: 2025-08-26 11:31:47
Benzoic acid 2-(2,4,6-trichlorophenyl) hydrazide structure
|
Common Name | Benzoic acid 2-(2,4,6-trichlorophenyl) hydrazide | ||
|---|---|---|---|---|
| CAS Number | 33422-33-2 | Molecular Weight | 315.58200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9Cl3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-Benzoyl-N'-(2,4,6-trichlor-phenyl)hydrazin |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H9Cl3N2O |
|---|---|
| Molecular Weight | 315.58200 |
| Exact Mass | 313.97800 |
| PSA | 41.13000 |
| LogP | 4.86760 |
| HS Code | 2928000090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:25939-05-3| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| N'-Benzoyl-N-2,4,6-trichlorphenylhydrazin |
| Benzoesaeure-[N'-(2,4,6-trichlor-phenyl)-hydrazid] |
| N-(2.4.6-Trichlor-phenyl)-N'-benzoyl-hydrazin |
| β-(2,4,6-Trichlorphenyl)-benzhydrazid |
| benzoic acid-[N'-(2,4,6-trichloro-phenyl)-hydrazide] |