1-[(dimethylamino)carbonyl]piperidine-4-carboxylic acid
Modify Date: 2025-09-12 11:57:15
![1-[(dimethylamino)carbonyl]piperidine-4-carboxylic acid Structure](https://image.chemsrc.com/caspic/195/333985-79-8.png)
1-[(dimethylamino)carbonyl]piperidine-4-carboxylic acid structure
|
Common Name | 1-[(dimethylamino)carbonyl]piperidine-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 333985-79-8 | Molecular Weight | 200.23500 | |
| Density | 1.215g/cm3 | Boiling Point | 378ºC at 760 mmHg | |
| Molecular Formula | C9H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.4ºC | |
| Name | 1-(dimethylcarbamoyl)piperidine-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.215g/cm3 |
|---|---|
| Boiling Point | 378ºC at 760 mmHg |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.23500 |
| Flash Point | 182.4ºC |
| Exact Mass | 200.11600 |
| PSA | 60.85000 |
| LogP | 0.40250 |
| Index of Refraction | 1.522 |
| InChIKey | FRBBOXGMTKVHBW-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)N1CCC(C(=O)O)CC1 |
| HS Code | 2933399090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
CAS#:333985-78-7![1-[bis(dimethylamino)methylene]piperidinium 4-carboxylate Structure](https://image.chemsrc.com/caspic/331/1219594-56-5.png)
CAS#:1219594-56-5| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(N,N-Dimethylcarbamoyl)-4-piperidine Carboxylic Acid |
| 1-[(dimethylamino)carbonyl]piperidine-4-carboxylic acid |
| 1-(Dimethylcarbamoyl)piperidine-4-carboxylicAcid |
| 1-(N,N-dimethylcarbamoyl)piperidine-4-carboxylic acid |