ethyl 5-(4-chlorobenzoyl)-alpha,1,4-trimethyl-1H-pyrrole-2-acetate structure
|
Common Name | ethyl 5-(4-chlorobenzoyl)-alpha,1,4-trimethyl-1H-pyrrole-2-acetate | ||
|---|---|---|---|---|
| CAS Number | 33369-43-6 | Molecular Weight | 333.80900 | |
| Density | 1.17g/cm3 | Boiling Point | 438.4ºC at 760mmHg | |
| Molecular Formula | C18H20ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.9ºC | |
| Name | ethyl 2-[5-(4-chlorobenzoyl)-1,4-dimethylpyrrol-2-yl]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.17g/cm3 |
|---|---|
| Boiling Point | 438.4ºC at 760mmHg |
| Molecular Formula | C18H20ClNO3 |
| Molecular Weight | 333.80900 |
| Flash Point | 218.9ºC |
| Exact Mass | 333.11300 |
| PSA | 48.30000 |
| LogP | 3.88450 |
| Index of Refraction | 1.558 |
| InChIKey | GYRBPBBVYDCYPC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)c1cc(C)c(C(=O)c2ccc(Cl)cc2)n1C |
| HS Code | 2933990090 |
|---|
|
~%
ethyl 5-(4-chlo... CAS#:33369-43-6 |
| Literature: Cell Pathways Inc Patent: US5939417 A1, 1999 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| einecs 251-475-8 |