(5-bromo-2-chlorophenyl)-(4-methoxyphenyl)methanone structure
|
Common Name | (5-bromo-2-chlorophenyl)-(4-methoxyphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 333361-49-2 | Molecular Weight | 325.58500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H10BrClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5-bromo-2-chlorophenyl)-(4-methoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H10BrClO2 |
|---|---|
| Molecular Weight | 325.58500 |
| Exact Mass | 323.95500 |
| PSA | 26.30000 |
| LogP | 4.34210 |
| InChIKey | NIEQZZXEZYUFMQ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2cc(Br)ccc2Cl)cc1 |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| (5-Bromo-2-chlorophenyl)(4-methoxyphenyl)methanone |