BENZYL-(3-NITRO-PHENYL)-AMINE structure
|
Common Name | BENZYL-(3-NITRO-PHENYL)-AMINE | ||
|---|---|---|---|---|
| CAS Number | 33334-94-0 | Molecular Weight | 228.24700 | |
| Density | 1.258g/cm3 | Boiling Point | 379.8ºC at 760mmHg | |
| Molecular Formula | C13H12N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.5ºC | |
| Name | N-Benzyl-3-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.258g/cm3 |
|---|---|
| Boiling Point | 379.8ºC at 760mmHg |
| Molecular Formula | C13H12N2O2 |
| Molecular Weight | 228.24700 |
| Flash Point | 183.5ºC |
| Exact Mass | 228.09000 |
| PSA | 57.85000 |
| LogP | 3.80310 |
| Index of Refraction | 1.658 |
| InChIKey | OVZNWAWUJPSLHM-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cccc(NCc2ccccc2)c1 |
| HS Code | 2921420090 |
|---|
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| F3097-0514 |
| N-(3-nitrophenyl)benzenemethanamine |
| N-benzyl-m-nitroaniline |
| (3-nitrophenyl)benzylamine |
| N-benzyl-3-nitrobenzenamine |
| N-benzyl-3-nitrophenylamine |
| N-(3-nitrophenyl)benzylamine |
| N-benzyl-3-nitro-aniline |