Bis(2-methoxyphenyl)-1,1,2,2-tetramethyldisilane structure
|
Common Name | Bis(2-methoxyphenyl)-1,1,2,2-tetramethyldisilane | ||
|---|---|---|---|---|
| CAS Number | 332343-84-7 | Molecular Weight | 330.56900 | |
| Density | 0.99g/cm3 | Boiling Point | 139-144ºC/4mm | |
| Molecular Formula | C18H26O2Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-methoxyphenyl)-[(2-methoxyphenyl)-dimethylsilyl]-dimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.99g/cm3 |
|---|---|
| Boiling Point | 139-144ºC/4mm |
| Molecular Formula | C18H26O2Si2 |
| Molecular Weight | 330.56900 |
| Exact Mass | 330.14700 |
| PSA | 18.46000 |
| LogP | 3.31320 |
| Index of Refraction | 1.517 |
| InChIKey | GTVBFJHBCZGREK-UHFFFAOYSA-N |
| SMILES | COc1ccccc1[Si](C)(C)[Si](C)(C)c1ccccc1OC |
| HS Code | 2931900090 |
|---|
|
~94%
Bis(2-methoxyph... CAS#:332343-84-7 |
| Literature: Lee, Thomas W.; Corey Organic Letters, 2001 , vol. 3, # 21 p. 3337 - 3339 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1,2-Bis(2-methoxyphenyl)-1,1,2,2-tetramethyldisilane |
| MFCD09265162 |
| Bis(2-methoxyphenyl)-1,1,2,2-tetramethyldisilane |
| AMTSi082 |
| bis(2-methoxyphenyl)tetramethyldisilane |