(S)-3-(4-HYDROXY-2,6-DIMETHYL-PHENYL)-2-METHYL-PROPIONICACID
Modify Date: 2025-10-02 09:19:05
(S)-3-(4-HYDROXY-2,6-DIMETHYL-PHENYL)-2-METHYL-PROPIONICACID structure
|
Common Name | (S)-3-(4-HYDROXY-2,6-DIMETHYL-PHENYL)-2-METHYL-PROPIONICACID | ||
|---|---|---|---|---|
| CAS Number | 332186-76-2 | Molecular Weight | 208.25400 | |
| Density | 1.148g/cm3 | Boiling Point | 385ºC at 760 mmHg | |
| Molecular Formula | C12H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.8ºC | |
| Name | (2S)-3-(4-hydroxy-2,6-dimethylphenyl)-2-methylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.148g/cm3 |
|---|---|
| Boiling Point | 385ºC at 760 mmHg |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.25400 |
| Flash Point | 200.8ºC |
| Exact Mass | 208.11000 |
| PSA | 57.53000 |
| LogP | 2.27220 |
| Index of Refraction | 1.554 |
| InChIKey | LPPITBJXYYCDEQ-VIFPVBQESA-N |
| SMILES | Cc1cc(O)cc(C)c1CC(C)C(=O)O |
| HS Code | 2918290000 |
|---|
| HS Code | 2918290000 |
|---|---|
| Summary | HS: 2918290000 other carboxylic acids with phenol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) VAT:17.0% MFN tariff:6.5% General tariff:30.0% |
| 2s-mdp |