CHEMBRDG-BB 5687532
Modify Date: 2024-01-30 20:33:37
CHEMBRDG-BB 5687532 structure
|
Common Name | CHEMBRDG-BB 5687532 | ||
|---|---|---|---|---|
| CAS Number | 332150-25-1 | Molecular Weight | 261.74700 | |
| Density | 1.167g/cm3 | Boiling Point | 380.9ºC at 760 mmHg | |
| Molecular Formula | C15H16ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.2ºC | |
| Name | 4-(4-chloro-2,6-dimethylquinolin-3-yl)butan-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 380.9ºC at 760 mmHg |
| Molecular Formula | C15H16ClNO |
| Molecular Weight | 261.74700 |
| Flash Point | 184.2ºC |
| Exact Mass | 261.09200 |
| PSA | 29.96000 |
| LogP | 4.02660 |
| Index of Refraction | 1.589 |
| InChIKey | JJTHOZONPXZBEY-UHFFFAOYSA-N |
| SMILES | CC(=O)CCc1c(C)nc2ccc(C)cc2c1Cl |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| hms2652m18 |