3,3-dimethyl-4-(4-nitrophenyl)butanoic acid
Modify Date: 2025-08-25 15:28:08
3,3-dimethyl-4-(4-nitrophenyl)butanoic acid structure
|
Common Name | 3,3-dimethyl-4-(4-nitrophenyl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 33209-64-2 | Molecular Weight | 237.25200 | |
| Density | 1.217g/cm3 | Boiling Point | 397.9ºC at 760 mmHg | |
| Molecular Formula | C12H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168ºC | |
| Name | 3,3-dimethyl-4-(4-nitrophenyl)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.217g/cm3 |
|---|---|
| Boiling Point | 397.9ºC at 760 mmHg |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25200 |
| Flash Point | 168ºC |
| Exact Mass | 237.10000 |
| PSA | 83.12000 |
| LogP | 3.16140 |
| Index of Refraction | 1.553 |
| InChIKey | DJHDFMZFVVNZCU-UHFFFAOYSA-N |
| SMILES | CC(C)(CC(=O)O)Cc1ccc([N+](=O)[O-])cc1 |
|
~%
3,3-dimethyl-4-... CAS#:33209-64-2 |
| Literature: Winstein,S.; Heck,R.F. Journal of Organic Chemistry, 1972 , vol. 37, p. 825 - 836 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,3-Dimethyl-4-p-nitrophenylbuttersaeure |