3,4-dihydroxy-1-(phenylmethyl) 2,5-pyrrolidinedione
Modify Date: 2024-01-22 15:41:18
3,4-dihydroxy-1-(phenylmethyl) 2,5-pyrrolidinedione structure
|
Common Name | 3,4-dihydroxy-1-(phenylmethyl) 2,5-pyrrolidinedione | ||
|---|---|---|---|---|
| CAS Number | 332040-86-5 | Molecular Weight | 221.20900 | |
| Density | 1.525g/cm3 | Boiling Point | 489.3ºC at 760mmHg | |
| Molecular Formula | C11H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.7ºC | |
| Name | 3,4-dihydroxy-1-(phenylmethyl) 2,5-pyrrolidinedione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.525g/cm3 |
|---|---|
| Boiling Point | 489.3ºC at 760mmHg |
| Molecular Formula | C11H11NO4 |
| Molecular Weight | 221.20900 |
| Flash Point | 249.7ºC |
| Exact Mass | 221.06900 |
| PSA | 77.84000 |
| Index of Refraction | 1.676 |
| InChIKey | IZBMPGFJNIDMRR-UHFFFAOYSA-N |
| SMILES | O=C1C(O)C(O)C(=O)N1Cc1ccccc1 |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 1-benzyl-3,4-dihydroxy-pyrrolidine-2,5-dione |
| ISOQUINOLINE,3,4-DIHYDRO-1-BENZYL |
| 1-benzyl-3,4-dihydro-isoquinoline |
| 1-Benzyl-3,4-dihydroxy-pyrrolidin-2,5-dion |
| 1-benzyl-2,5-dioxo-3,4-dihydroxy-pyrrolidine |
| 1-Benzyl-3.4-dihydro-isochinolin |