1,1,1,7,7,7-Hexafluoro-4-heptanone structure
|
Common Name | 1,1,1,7,7,7-Hexafluoro-4-heptanone | ||
|---|---|---|---|---|
| CAS Number | 332-86-5 | Molecular Weight | 222.12800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H8F6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,1,1,7,7,7-hexafluoro-heptan-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H8F6O |
|---|---|
| Molecular Weight | 222.12800 |
| Exact Mass | 222.04800 |
| PSA | 17.07000 |
| LogP | 3.24050 |
| InChIKey | WLFTZMAAXHUNDE-UHFFFAOYSA-N |
| SMILES | O=C(CCC(F)(F)F)CCC(F)(F)F |
| HS Code | 2914700090 |
|---|
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1,1,1,7,7,7-Hexafluor-heptan-4-on |
| 1,1,1,7,7,7-hexafluoroheptan-4-one |