CHEMBRDG-BB 5404459
Modify Date: 2024-01-14 16:03:30
CHEMBRDG-BB 5404459 structure
|
Common Name | CHEMBRDG-BB 5404459 | ||
|---|---|---|---|---|
| CAS Number | 331670-05-4 | Molecular Weight | 246.25900 | |
| Density | 1.219g/cm3 | Boiling Point | 409.9ºC at 760 mmHg | |
| Molecular Formula | C14H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.7ºC | |
| Name | 5-methyl-4-[(4-methylphenoxy)methyl]furan-2-carboxylic acid |
|---|
| Density | 1.219g/cm3 |
|---|---|
| Boiling Point | 409.9ºC at 760 mmHg |
| Molecular Formula | C14H14O4 |
| Molecular Weight | 246.25900 |
| Flash Point | 201.7ºC |
| Exact Mass | 246.08900 |
| PSA | 59.67000 |
| LogP | 3.17360 |
| Index of Refraction | 1.57 |
| InChIKey | AWXJBCZMGZDXCG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OCc2cc(C(=O)O)oc2C)cc1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |