2-[(4-methylphenoxy)methyl]furan-3-carboxylic acid structure
|
Common Name | 2-[(4-methylphenoxy)methyl]furan-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 331670-04-3 | Molecular Weight | 232.23200 | |
| Density | 1.25g/cm3 | Boiling Point | 387.5ºC at 760 mmHg | |
| Molecular Formula | C13H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.1ºC | |
| Name | 2-[(4-methylphenoxy)methyl]furan-3-carboxylic acid |
|---|
| Density | 1.25g/cm3 |
|---|---|
| Boiling Point | 387.5ºC at 760 mmHg |
| Molecular Formula | C13H12O4 |
| Molecular Weight | 232.23200 |
| Flash Point | 188.1ºC |
| Exact Mass | 232.07400 |
| PSA | 59.67000 |
| LogP | 2.86520 |
| Index of Refraction | 1.576 |
| InChIKey | YUKSPCVAXVOFAB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(OCc2occc2C(=O)O)cc1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |