2,2'-(2-methylpropylidene)bis[4,6-xylenol] structure
|
Common Name | 2,2'-(2-methylpropylidene)bis[4,6-xylenol] | ||
|---|---|---|---|---|
| CAS Number | 33145-10-7 | Molecular Weight | 298.41900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2'-isobutylidenebis(4,6-dimethylphenol) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H26O2 |
|---|---|
| Molecular Weight | 298.41900 |
| Exact Mass | 298.19300 |
| PSA | 40.46000 |
| LogP | 5.11930 |
| InChIKey | SZAQZZKNQILGPU-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(O)c(C(c2cc(C)cc(C)c2O)C(C)C)c1 |
| HS Code | 2907299090 |
|---|
| HS Code | 2907299090 |
|---|---|
| Summary | 2907299090 polyphenols; phenol-alcohols。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:5.5%。general tariff:30.0% |
| PHENOL,2,2'-(2-METHYLPROPYLIDENE)BIS[4,6-DIMETHYL- |
| 4,6,4'',6''-Tetramethyl-2,2''-isobutyliden-di-phenol |
| 4,6,4'',6''-tetramethyl-2,2''-isobutylidene-di-phenol |
| 2-Methyl-1,1-bis-(2-hydroxy-3,5-dimethyl-phenyl)-propan |
| 2,2'-(2-METHYLPROPYLIDENE)BIS[4,6-XYLENOL] |
| metaseol |
| 2,2-bis(4-propargyloxyphenyl)propane |
| 1,1-bis(2-hydroxy-3,5-dimethylbenzene)-dimethyl ethane |