Broperamole
Modify Date: 2025-10-30 01:28:19
Broperamole structure
|
Common Name | Broperamole | ||
|---|---|---|---|---|
| CAS Number | 33144-79-5 | Molecular Weight | 364.24000 | |
| Density | 1.55g/cm3 | Boiling Point | 562.2ºC at 760 mmHg | |
| Molecular Formula | C15H18BrN5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 293.8ºC | |
| Name | 3-[5-(3-bromophenyl)tetrazol-2-yl]-1-piperidin-1-ylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.55g/cm3 |
|---|---|
| Boiling Point | 562.2ºC at 760 mmHg |
| Molecular Formula | C15H18BrN5O |
| Molecular Weight | 364.24000 |
| Flash Point | 293.8ºC |
| Exact Mass | 363.06900 |
| PSA | 63.91000 |
| LogP | 2.44310 |
| Index of Refraction | 1.69 |
| InChIKey | PLZMRGRLCWCLFW-UHFFFAOYSA-N |
| SMILES | O=C(CCn1nnc(-c2cccc(Br)c2)n1)N1CCCCC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| TR-2378 |
| BROPERAMOLE |
| Broperamol [INN-Spanish] |
| Broperamol |
| Broperamolum [INN-Latin] |
| Broperamolum |
| Broperamole (USAN/INN) |
| 1-{3-[5-(3-bromo-phenyl)-tetrazol-2-yl]-propionyl}-piperidine |