meso-2-exo,3-exo-dibromobicyclo[2.2.1]hept-5-ene-2-endo,3-endo-dicarboxylic anhydride
Modify Date: 2025-09-27 10:43:50
![meso-2-exo,3-exo-dibromobicyclo[2.2.1]hept-5-ene-2-endo,3-endo-dicarboxylic anhydride Structure](https://image.chemsrc.com/caspic/232/33140-59-9.png)
meso-2-exo,3-exo-dibromobicyclo[2.2.1]hept-5-ene-2-endo,3-endo-dicarboxylic anhydride structure
|
Common Name | meso-2-exo,3-exo-dibromobicyclo[2.2.1]hept-5-ene-2-endo,3-endo-dicarboxylic anhydride | ||
|---|---|---|---|---|
| CAS Number | 33140-59-9 | Molecular Weight | 321.95000 | |
| Density | 2.384g/cm3 | Boiling Point | 395.2ºC at 760 mmHg | |
| Molecular Formula | C9H6Br2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 192.8ºC | |
| Name | meso-2-exo,3-exo-dibromobicyclo[2.2.1]hept-5-ene-2-endo,3-endo-dicarboxylic anhydride |
|---|---|
| Synonym | More Synonyms |
| Density | 2.384g/cm3 |
|---|---|
| Boiling Point | 395.2ºC at 760 mmHg |
| Molecular Formula | C9H6Br2O3 |
| Molecular Weight | 321.95000 |
| Flash Point | 192.8ºC |
| Exact Mass | 319.86800 |
| PSA | 43.37000 |
| LogP | 1.54310 |
| Index of Refraction | 1.74 |
| InChIKey | GJFXBTXPLZPKBO-UHFFFAOYSA-N |
| SMILES | O=C1OC(=O)C2(Br)C3C=CC(C3)C12Br |
|
~62%
meso-2-exo,3-ex... CAS#:33140-59-9 |
| Literature: Carman; Derbyshire; Hansford; Kadirvelraj; Robinson Australian Journal of Chemistry, 2001 , vol. 54, # 2 p. 117 - 126 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:129-64-6| 2exo,3exo-dibromo-norborn-5-ene-2endo,3endo-dicarboxylic acid-anhydride |
| 2exo,3exo-Dibrom-norborn-5-en-2endo,3endo-dicarbonsaeure-anhydrid |