benzhydryl 2-benzamidoacetate
Modify Date: 2025-09-26 21:37:14
benzhydryl 2-benzamidoacetate structure
|
Common Name | benzhydryl 2-benzamidoacetate | ||
|---|---|---|---|---|
| CAS Number | 3312-89-8 | Molecular Weight | 345.39100 | |
| Density | 1.187g/cm3 | Boiling Point | 553.2ºC at 760 mmHg | |
| Molecular Formula | C22H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288.4ºC | |
| Name | benzhydryl 2-benzamidoacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.187g/cm3 |
|---|---|
| Boiling Point | 553.2ºC at 760 mmHg |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.39100 |
| Flash Point | 288.4ºC |
| Exact Mass | 345.13600 |
| PSA | 55.40000 |
| LogP | 4.14010 |
| Index of Refraction | 1.602 |
| InChIKey | MACGMAIGMLWORX-UHFFFAOYSA-N |
| SMILES | O=C(CNC(=O)c1ccccc1)OC(c1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~92%
benzhydryl 2-be... CAS#:3312-89-8 |
| Literature: Kolovos, Miltiadis; Froussios, Cleanthis Tetrahedron Letters, 1984 , vol. 25, # 35 p. 3909 - 3912 |
|
~%
benzhydryl 2-be... CAS#:3312-89-8 |
| Literature: Kolovos, Miltiadis; Froussios, Cleanthis Tetrahedron Letters, 1984 , vol. 25, # 35 p. 3909 - 3912 |
|
~%
benzhydryl 2-be... CAS#:3312-89-8 |
| Literature: Kolovos, Miltiadis; Froussios, Cleanthis Tetrahedron Letters, 1984 , vol. 25, # 35 p. 3909 - 3912 |
|
~%
benzhydryl 2-be... CAS#:3312-89-8 |
| Literature: Friedler; Smith Biochemical Journal, 1954 , vol. 57, p. 396,397 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Benzoyl-glycin-diphenylmethylester |
| hippuric acid benzhydryl ester |
| Hippursaeure-benzhydrylester |
| diphenylmethyl n-benzoylglycinate |