2H-Isoindole-2-aceticacid, 1,3-dihydro-1,3-dioxo-, diphenylmethyl ester
Modify Date: 2025-11-13 23:19:36
2H-Isoindole-2-aceticacid, 1,3-dihydro-1,3-dioxo-, diphenylmethyl ester structure
|
Common Name | 2H-Isoindole-2-aceticacid, 1,3-dihydro-1,3-dioxo-, diphenylmethyl ester | ||
|---|---|---|---|---|
| CAS Number | 3312-88-7 | Molecular Weight | 371.38500 | |
| Density | 1.304g/cm3 | Boiling Point | 528.3ºC at 760mmHg | |
| Molecular Formula | C23H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.3ºC | |
| Name | N,N-phthaloyl-glycine benzhydryl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.304g/cm3 |
|---|---|
| Boiling Point | 528.3ºC at 760mmHg |
| Molecular Formula | C23H17NO4 |
| Molecular Weight | 371.38500 |
| Flash Point | 273.3ºC |
| Exact Mass | 371.11600 |
| PSA | 63.68000 |
| LogP | 3.55330 |
| Index of Refraction | 1.637 |
| InChIKey | VIMNAGUHHMYDKH-UHFFFAOYSA-N |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)OC(c1ccccc1)c1ccccc1 |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Allyl-N-phthalimidacetat |
| Phthaloylglycin-benzhydrylester |
| N,N-phthaloyl-glycine allyl ester |
| Phthaloylglycin-allylester |