1-(4-nitro-3-pyrrolidin-1-ylphenyl)piperazine
Modify Date: 2025-09-02 16:29:36
1-(4-nitro-3-pyrrolidin-1-ylphenyl)piperazine structure
|
Common Name | 1-(4-nitro-3-pyrrolidin-1-ylphenyl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 330633-83-5 | Molecular Weight | 276.33400 | |
| Density | 1.233g/cm3 | Boiling Point | 493.8ºC at 760 mmHg | |
| Molecular Formula | C14H20N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 252.4ºC | |
| Name | 1-(4-nitro-3-pyrrolidin-1-ylphenyl)piperazine |
|---|
| Density | 1.233g/cm3 |
|---|---|
| Boiling Point | 493.8ºC at 760 mmHg |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.33400 |
| Flash Point | 252.4ºC |
| Exact Mass | 276.15900 |
| PSA | 64.33000 |
| LogP | 2.58660 |
| Index of Refraction | 1.598 |
| InChIKey | HAVYTZCTAHRQNI-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N2CCNCC2)cc1N1CCCC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |