1-(2-chloroethyl)-3-(3,4,5-trimethoxyphenyl)urea structure
|
Common Name | 1-(2-chloroethyl)-3-(3,4,5-trimethoxyphenyl)urea | ||
|---|---|---|---|---|
| CAS Number | 33021-68-0 | Molecular Weight | 288.72700 | |
| Density | 1.248g/cm3 | Boiling Point | 384.1ºC at 760 mmHg | |
| Molecular Formula | C12H17ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.1ºC | |
| Name | N-<2-Chlor-aethyl>-N'-<2,6-cyclo-norbornan-3-yl>-harnstoff |
|---|---|
| Synonym | More Synonyms |
| Density | 1.248g/cm3 |
|---|---|
| Boiling Point | 384.1ºC at 760 mmHg |
| Molecular Formula | C12H17ClN2O4 |
| Molecular Weight | 288.72700 |
| Flash Point | 186.1ºC |
| Exact Mass | 288.08800 |
| PSA | 68.82000 |
| LogP | 2.53660 |
| Index of Refraction | 1.549 |
| InChIKey | RVSXAKGVAATORR-UHFFFAOYSA-N |
| SMILES | COc1cc(NC(=O)NCCCl)cc(OC)c1OC |
|
~%
1-(2-chloroethy... CAS#:33021-68-0 |
| Literature: Johnston; McCaleb; Opliger; Laster; Montgomery Journal of medicinal chemistry, 1971 , vol. 14, # 17 p. 600 - 614 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-<2-Chlor-aethyl>-N'-<tricyclo<2.2.1.02,6>hept-3-yl>-harnstoff |
| 1-(2-chloroethyl)-3-tricyclo[2.2.1.02,6]hept-3-ylurea |
| N-<2-Chlor-aethyl>-N'-<3,4,5-trimethoxy-phenyl>-harnstoff |
| 1-(2-chloroethyl)-3-(3,4,5-trimethoxyphenyl)-urea |