N-(6-chloropyridin-2-yl)-N',N'-dimethylethane-1,2-diamine
Modify Date: 2024-04-02 09:59:02
N-(6-chloropyridin-2-yl)-N',N'-dimethylethane-1,2-diamine structure
|
Common Name | N-(6-chloropyridin-2-yl)-N',N'-dimethylethane-1,2-diamine | ||
|---|---|---|---|---|
| CAS Number | 3298-28-0 | Molecular Weight | 199.68100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(6-chloropyridin-2-yl)-N',N'-dimethylethane-1,2-diamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H14ClN3 |
|---|---|
| Molecular Weight | 199.68100 |
| Exact Mass | 199.08800 |
| PSA | 28.16000 |
| LogP | 1.78150 |
| HS Code | 2933399090 |
|---|
|
~70%
N-(6-chloropyri... CAS#:3298-28-0 |
| Literature: Merck and Co., Inc. Patent: US4203988 A1, 1980 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Dimethylaminoethylamino-6-chlor-pyridin |