HAP-1
Modify Date: 2024-04-07 13:42:33
HAP-1 structure
|
Common Name | HAP-1 | ||
|---|---|---|---|---|
| CAS Number | 329004-38-8 | Molecular Weight | 1335.47 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C60H90N18O17 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HAP-1HAP-1 is a synovial-targeted transduction peptide. HAP-1 facilitates specific internalization of protein complexes into human and rabbit synovial cells. HAP-1 fused to an antimicrobial peptide, (KLAK)2, to generate a proapoptotic peptide DP2[1]. |
| Name | HAP-1 |
|---|
| Description | HAP-1 is a synovial-targeted transduction peptide. HAP-1 facilitates specific internalization of protein complexes into human and rabbit synovial cells. HAP-1 fused to an antimicrobial peptide, (KLAK)2, to generate a proapoptotic peptide DP2[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C60H90N18O17 |
|---|---|
| Molecular Weight | 1335.47 |
| InChIKey | OESNJIQESULMGZ-FAHRUCGCSA-N |
| SMILES | CC(C)CC(NC(=O)C(NC(=O)C(C)NC(=O)C(CCCN=C(N)N)NC(=O)C(C)NC(=O)C(Cc1ccccc1)NC(=O)C(CCC(N)=O)NC(=O)C(Cc1cnc[nH]1)NC(=O)C(Cc1ccccc1)NC(=O)C(N)CO)C(C)O)C(=O)NC(C)C(=O)NC(CO)C(=O)O |