2(1H)-Pyridinone,1-methyl-5-nitro- structure
|
Common Name | 2(1H)-Pyridinone,1-methyl-5-nitro- | ||
|---|---|---|---|---|
| CAS Number | 32896-90-5 | Molecular Weight | 154.12300 | |
| Density | 1.37g/cm3 | Boiling Point | 287.5ºC at 760mmHg | |
| Molecular Formula | C6H6N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 127.7ºC | |
| Name | 1-methyl-5-nitropyridin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 287.5ºC at 760mmHg |
| Molecular Formula | C6H6N2O3 |
| Molecular Weight | 154.12300 |
| Flash Point | 127.7ºC |
| Exact Mass | 154.03800 |
| PSA | 67.82000 |
| LogP | 0.81670 |
| Index of Refraction | 1.582 |
| InChIKey | FZYSOPYUSSFGAO-UHFFFAOYSA-N |
| SMILES | Cn1cc([N+](=O)[O-])ccc1=O |
| HS Code | 2933399090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 4 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-nitro-N-methylpyridone |
| 1-Methyl-5-nitro-2-pyridone |
| 1,6-dihydro-1-methyl-3-nitropyridin-6-one |