DNPS-piperidine
Modify Date: 2025-08-20 08:36:59
DNPS-piperidine structure
|
Common Name | DNPS-piperidine | ||
|---|---|---|---|---|
| CAS Number | 32894-59-0 | Molecular Weight | 283.30400 | |
| Density | 1.43g/cm3 | Boiling Point | 432.2ºC at 760 mmHg | |
| Molecular Formula | C11H13N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.2ºC | |
| Name | 1-(2,4-dinitrophenyl)sulfanylpiperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 432.2ºC at 760 mmHg |
| Molecular Formula | C11H13N3O4S |
| Molecular Weight | 283.30400 |
| Flash Point | 215.2ºC |
| Exact Mass | 283.06300 |
| PSA | 120.18000 |
| LogP | 3.98030 |
| Index of Refraction | 1.647 |
| InChIKey | DKAPZAWOVZXGAE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(SN2CCCCC2)c([N+](=O)[O-])c1 |
| HS Code | 2933399090 |
|---|
|
~%
DNPS-piperidine CAS#:32894-59-0 |
| Literature: Lecher; Hardy Journal of Organic Chemistry, 1955 , vol. 20, p. 475,486 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| DNPS-piperidine |
| N-(2,4-Dinitrobenzol-sulfenyl)-piperidin |
| 1-(2,4-dinitro-benzenesulfenyl)-piperidine |
| 1-(2,4-Dinitro-benzolsulfenyl)-piperidin |
| 1-(2,4-dinitro-phenylsulfanyl)-piperidine |