5,5,5-trifluoro-3-(trifluoromethyl)pent-3-en-2-ol structure
|
Common Name | 5,5,5-trifluoro-3-(trifluoromethyl)pent-3-en-2-ol | ||
|---|---|---|---|---|
| CAS Number | 32885-94-2 | Molecular Weight | 208.10200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H6F6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,5,5-trifluoro-3-(trifluoromethyl)pent-3-en-2-ol |
|---|
| Molecular Formula | C6H6F6O |
|---|---|
| Molecular Weight | 208.10200 |
| Exact Mass | 208.03200 |
| PSA | 20.23000 |
| LogP | 2.41820 |
| InChIKey | YRUGLHPOFHPHDJ-UHFFFAOYSA-N |
| SMILES | CC(O)C(=CC(F)(F)F)C(F)(F)F |
|
~%
5,5,5-trifluoro... CAS#:32885-94-2 |
| Literature: Nishida, Masakazu; Hayakawa, Yoshio; Matsui, Masaki; Shibata, Katsuyoshi; Muramatsu, Hiroshige Bulletin of the Chemical Society of Japan, 1991 , vol. 64, # 11 p. 3494 - 3496 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |