Isoquinoline,4-[(3,4-dimethoxyphenyl)methyl]- 6,7-dimethoxy- structure
|
Common Name | Isoquinoline,4-[(3,4-dimethoxyphenyl)methyl]- 6,7-dimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 32871-93-5 | Molecular Weight | 339.38500 | |
| Density | 1.161g/cm3 | Boiling Point | 496.5ºC at 760 mmHg | |
| Molecular Formula | C20H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.4ºC | |
| Name | 4-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxyisoquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.161g/cm3 |
|---|---|
| Boiling Point | 496.5ºC at 760 mmHg |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.38500 |
| Flash Point | 176.4ºC |
| Exact Mass | 339.14700 |
| PSA | 49.81000 |
| LogP | 3.86000 |
| Index of Refraction | 1.587 |
| InChIKey | MGDZAXIOQRQEIT-UHFFFAOYSA-N |
| SMILES | COc1ccc(Cc2cncc3cc(OC)c(OC)cc23)cc1OC |
| HS Code | 2933499090 |
|---|
|
~30%
Isoquinoline,4-... CAS#:32871-93-5 |
| Literature: Christinaki, Helene; Bister-Miel, Francoise; Hammoumi, Abderahmane; Bury, Michele; Guignard, Jean-Louis; Viel, Claude Phytochemistry (Elsevier), 1987 , vol. 26, # 11 p. 2991 - 2994 |
|
~%
Isoquinoline,4-... CAS#:32871-93-5 |
| Literature: Christinaki, Helene; Bister-Miel, Francoise; Hammoumi, Abderahmane; Bury, Michele; Guignard, Jean-Louis; Viel, Claude Phytochemistry (Elsevier), 1987 , vol. 26, # 11 p. 2991 - 2994 |
|
~%
Isoquinoline,4-... CAS#:32871-93-5 |
| Literature: Christinaki, Helene; Bister-Miel, Francoise; Hammoumi, Abderahmane; Bury, Michele; Guignard, Jean-Louis; Viel, Claude Phytochemistry (Elsevier), 1987 , vol. 26, # 11 p. 2991 - 2994 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| isopapaverine |
| 6,7-dimethoxy-4-(3',4'-dimethoxybenzyl)isoquinoline |
| 4-(3,4-dimethoxybenzyl)-6,7-dimethoxyisoquinoline |
| 6,7-Dimethoxy-4-(3',4'-dimethoxybenzyl)-isochinolin |