2H-Benzimidazole-2-thione,1,3-dihydro-5,6-dimethyl-
Modify Date: 2025-08-25 18:54:33
2H-Benzimidazole-2-thione,1,3-dihydro-5,6-dimethyl- structure
|
Common Name | 2H-Benzimidazole-2-thione,1,3-dihydro-5,6-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 3287-79-4 | Molecular Weight | 178.25400 | |
| Density | 1.27g/cm3 | Boiling Point | 299.7ºC at 760mmHg | |
| Molecular Formula | C9H10N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.1ºC | |
| Name | 5,6-dimethyl-1,3-dihydrobenzimidazole-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 299.7ºC at 760mmHg |
| Molecular Formula | C9H10N2S |
| Molecular Weight | 178.25400 |
| Flash Point | 135.1ºC |
| Exact Mass | 178.05600 |
| PSA | 63.67000 |
| LogP | 2.84230 |
| Index of Refraction | 1.681 |
| InChIKey | CKUXMYYDAQIJRQ-UHFFFAOYSA-N |
| SMILES | Cc1cc2[nH]c(=S)[nH]c2cc1C |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-mercapto-5,6-dimethylbenzimidazole |
| 5,6-dimethyl-1H-benzimidazole-2-thiol |
| 5,6-dimethyl-1,3-dihydro-benzoimidazole-2-thione |
| 5,6-dimethylbenzimidazole-2-thiol |
| 5,6-dimethyl-2-mercaptobenzimidazole |
| 5,6-DIMETHYL-1H-BENZOIMIDAZOLE-2-THIOL |