3-nitro-9-phenoxyacridine
Modify Date: 2025-08-25 22:24:18
3-nitro-9-phenoxyacridine structure
|
Common Name | 3-nitro-9-phenoxyacridine | ||
|---|---|---|---|---|
| CAS Number | 32841-11-5 | Molecular Weight | 316.31000 | |
| Density | 1.355g/cm3 | Boiling Point | 529.6ºC at 760 mmHg | |
| Molecular Formula | C19H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 274.1ºC | |
| Name | 3-nitro-9-phenoxyacridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.355g/cm3 |
|---|---|
| Boiling Point | 529.6ºC at 760 mmHg |
| Molecular Formula | C19H12N2O3 |
| Molecular Weight | 316.31000 |
| Flash Point | 274.1ºC |
| Exact Mass | 316.08500 |
| PSA | 67.94000 |
| LogP | 5.61170 |
| Index of Refraction | 1.728 |
| InChIKey | SRUPPBCXPTTYQA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2c(Oc3ccccc3)c3ccccc3nc2c1 |
| HS Code | 2933990090 |
|---|
|
~%
3-nitro-9-pheno... CAS#:32841-11-5 |
| Literature: I.G.Farbenind. Patent: DE498661 , 1928 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 17, p. 2450 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-nitro-9-phenoxy-acridine |
| Acridine,3-nitro-9-phenoxy |
| 6-Nitro-9-phenoxyacridin |