N,N,N',N'-Tetrakis(4-nitrophenyl)-p-phenylenediamine structure
|
Common Name | N,N,N',N'-Tetrakis(4-nitrophenyl)-p-phenylenediamine | ||
|---|---|---|---|---|
| CAS Number | 3283-05-4 | Molecular Weight | 592.51500 | |
| Density | 1.484g/cm3 | Boiling Point | 790.5ºC at 760 mmHg | |
| Molecular Formula | C30H20N6O8 | Melting Point | 392°C(lit.) | |
| MSDS | N/A | Flash Point | 431.9ºC | |
| Name | 1-N,1-N,4-N,4-N-tetrakis(4-nitrophenyl)benzene-1,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.484g/cm3 |
|---|---|
| Boiling Point | 790.5ºC at 760 mmHg |
| Melting Point | 392°C(lit.) |
| Molecular Formula | C30H20N6O8 |
| Molecular Weight | 592.51500 |
| Flash Point | 431.9ºC |
| Exact Mass | 592.13400 |
| PSA | 189.76000 |
| LogP | 10.35180 |
| Index of Refraction | 1.734 |
| InChIKey | XEUNCVYZWDLKKR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(N(c2ccc(N(c3ccc([N+](=O)[O-])cc3)c3ccc([N+](=O)[O-])cc3)cc2)c2ccc([N+](=O)[O-])cc2)cc1 |
| HS Code | 2921590090 |
|---|
|
~97%
N,N,N',N'-Tetra... CAS#:3283-05-4 |
| Literature: FUJIFILM Corporation Patent: EP1767587 A2, 2007 ; Location in patent: Page/Page column 14-15 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N,N,N',N'-Tetrakis(4-nitrophenyl)-1,4-benzenediamine |
| N1,N1,N4,N4-Tetrakis(4-nitrophenyl)benzene-1,4-diamine |
| N,N,N',N'-Tetrakis(4-nitrophenyl)-p-phenylenediamine |