4-(3-chloro-4-propan-2-ylphenyl)butanoic acid
Modify Date: 2025-08-26 17:10:40
4-(3-chloro-4-propan-2-ylphenyl)butanoic acid structure
|
Common Name | 4-(3-chloro-4-propan-2-ylphenyl)butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 32808-58-5 | Molecular Weight | 240.72600 | |
| Density | 1.135g/cm3 | Boiling Point | 352.2ºC at 760 mmHg | |
| Molecular Formula | C13H17ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 166.8ºC | |
| Name | 4-(3-chloro-4-propan-2-ylphenyl)butanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.135g/cm3 |
|---|---|
| Boiling Point | 352.2ºC at 760 mmHg |
| Molecular Formula | C13H17ClO2 |
| Molecular Weight | 240.72600 |
| Flash Point | 166.8ºC |
| Exact Mass | 240.09200 |
| PSA | 37.30000 |
| LogP | 3.87070 |
| Index of Refraction | 1.532 |
| InChIKey | KXUCCGSLDRENQN-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(CCCC(=O)O)cc1Cl |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 3-Chloro-4-isopropylbenzenebutanoic acid |
| CB 848 |