1-(3-nitrophenyl)-N-(1,2,4-triazol-4-yl)methanimine structure
|
Common Name | 1-(3-nitrophenyl)-N-(1,2,4-triazol-4-yl)methanimine | ||
|---|---|---|---|---|
| CAS Number | 32787-80-7 | Molecular Weight | 217.18400 | |
| Density | 1.44g/cm3 | Boiling Point | 425.1ºC at 760 mmHg | |
| Molecular Formula | C9H7N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.9ºC | |
| Name | (E)-1-(3-nitrophenyl)-N-(4H-1,2,4-triazol-4-yl)methanimine |
|---|
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 425.1ºC at 760 mmHg |
| Molecular Formula | C9H7N5O2 |
| Molecular Weight | 217.18400 |
| Flash Point | 210.9ºC |
| Exact Mass | 217.06000 |
| PSA | 88.89000 |
| LogP | 1.59170 |
| Index of Refraction | 1.69 |
| InChIKey | FAUGLCGCOYUPKR-LFYBBSHMSA-N |
| SMILES | O=[N+]([O-])c1cccc(C=Nn2cnnc2)c1 |
|
~%
1-(3-nitropheny... CAS#:32787-80-7 |
| Literature: Letunov, V. I. Journal of Organic Chemistry USSR (English Translation), 1984 , vol. 20, p. 145 - 149 Zhurnal Organicheskoi Khimii, 1984 , vol. 20, # 1 p. 162 - 166 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |