(3aR,5R,6S,6aS)-6-chloro-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole structure
|
Common Name | (3aR,5R,6S,6aS)-6-chloro-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole | ||
|---|---|---|---|---|
| CAS Number | 32785-94-7 | Molecular Weight | 278.72900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19ClO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3aR,5R,6S,6aS)-6-chloro-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H19ClO5 |
|---|---|
| Molecular Weight | 278.72900 |
| Exact Mass | 278.09200 |
| PSA | 46.15000 |
| LogP | 1.62170 |
| InChIKey | VCDDIVCAQXJYLP-JDDHQFAOSA-N |
| SMILES | CC1(C)OCC(C2OC3OC(C)(C)OC3C2Cl)O1 |
|
~96%
(3aR,5R,6S,6aS)... CAS#:32785-94-7 |
| Literature: Azad, Chandra S.; Saxena, Anil K. Tetrahedron, 2013 , vol. 69, # 12 p. 2608 - 2612 |
|
~%
(3aR,5R,6S,6aS)... CAS#:32785-94-7 |
| Literature: Liebigs Annalen der Chemie, , # 7 p. 1245 - 1260 |
|
~%
(3aR,5R,6S,6aS)... CAS#:32785-94-7 |
| Literature: Journal of the Chemical Society, , p. 10,16 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-Chloro-3-deoxy-1,2:5,6-di-O-isopropylidene-a-D-glucofuranose |