Bicyclo[3.2.1]octane-2,4-dione,1,8,8-trimethyl-
Modify Date: 2025-10-11 17:35:42
![Bicyclo[3.2.1]octane-2,4-dione,1,8,8-trimethyl- Structure](https://image.chemsrc.com/caspic/241/3278-94-2.png)
Bicyclo[3.2.1]octane-2,4-dione,1,8,8-trimethyl- structure
|
Common Name | Bicyclo[3.2.1]octane-2,4-dione,1,8,8-trimethyl- | ||
|---|---|---|---|---|
| CAS Number | 3278-94-2 | Molecular Weight | 180.24400 | |
| Density | 1.065g/cm3 | Boiling Point | 273.3ºC at 760 mmHg | |
| Molecular Formula | C11H16O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 101.4ºC | |
| Name | 5,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.065g/cm3 |
|---|---|
| Boiling Point | 273.3ºC at 760 mmHg |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.24400 |
| Flash Point | 101.4ºC |
| Exact Mass | 180.11500 |
| PSA | 34.14000 |
| LogP | 1.97080 |
| Index of Refraction | 1.492 |
| InChIKey | ZTIUZVPQAUZNLG-UHFFFAOYSA-N |
| SMILES | CC12CCC(C(=O)CC1=O)C2(C)C |
|
~%
Bicyclo[3.2.1]o... CAS#:3278-94-2 |
| Literature: Shitole, H.R.; Nayak, U.R. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1984 , vol. 23, # 5 p. 415 - 417 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,3-Dimethyl-bicyclo<2.2.2>octan-2-on |
| Homocamphenilon |
| 1,8,8-Trimethyl-bicyclo<3.2.1>octan-2,4-dion |
| homocamphorquinoline |
| Homocamphorquinone |
| 3,3-dimethylbicyclo<2.2.2>octan-2-one |