4,4'-Bis(maleimido)-1,1'-biphenyl
Modify Date: 2025-09-11 20:08:47
4,4'-Bis(maleimido)-1,1'-biphenyl structure
|
Common Name | 4,4'-Bis(maleimido)-1,1'-biphenyl | ||
|---|---|---|---|---|
| CAS Number | 3278-30-6 | Molecular Weight | 344.32000 | |
| Density | 1.456g/cm3 | Boiling Point | 581.4ºC at 760mmHg | |
| Molecular Formula | C20H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 281.7ºC | |
| Name | 1-[4-[4-(2,5-dioxopyrrol-1-yl)phenyl]phenyl]pyrrole-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.456g/cm3 |
|---|---|
| Boiling Point | 581.4ºC at 760mmHg |
| Molecular Formula | C20H12N2O4 |
| Molecular Weight | 344.32000 |
| Flash Point | 281.7ºC |
| Exact Mass | 344.08000 |
| PSA | 74.76000 |
| LogP | 2.34240 |
| Index of Refraction | 1.696 |
| InChIKey | DEUOGTWMGGLRID-UHFFFAOYSA-N |
| SMILES | O=C1C=CC(=O)N1c1ccc(-c2ccc(N3C(=O)C=CC3=O)cc2)cc1 |
| HS Code | 2925190090 |
|---|
|
~%
4,4'-Bis(maleim... CAS#:3278-30-6 |
| Literature: Kovacic; Hein Journal of the American Chemical Society, 1959 , vol. 81, p. 1187,1189 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| N,N'-4,4'-Diphenylendimaleamid |
| 1,1'-Biphenyl-4,4'-diyl-bis-pyrrol-2,5-dion |
| 1,1'-biphenyl-4,4'-diyl-bis-pyrrole-2,5-dione |
| 1,1'-biphenyl-4,4'-diylbis(1h-pyrrole-2,5-dione) |